C13H16N2S2 — CID 80527912
N-[(2-methylthiolan-2-yl)methyl]thieno[3,2-c]pyridin-4-amine (PubChem CID 80527912) has the molecular formula C13H16N2S2 and a molecular weight of 264.42 g/mol. Its IUPAC name is N-[(2-methylthiolan-2-yl)methyl]thieno[3,2-c]pyridin-4-amine.
| Compound Name | N-[(2-methylthiolan-2-yl)methyl]thieno[3,2-c]pyridin-4-amine |
|---|---|
| PubChem CID | 80527912 |
| Molecular Formula | C13H16N2S2 |
| Molecular Weight | 264.42 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | N-[(2-methylthiolan-2-yl)methyl]thieno[3,2-c]pyridin-4-amine |
| SMILES | CC1(CNc2nccc3sccc23)CCCS1 |
| InChI | InChI=1S/C13H16N2S2/c1-13(5-2-7-17-13)9-15-12-10-4-8-16-11(10)3-6-14-12/h3-4,6,8H,2,5,7,9H2,1H3,(H,14,15) |
| InChIKey | MEZHLFLGQRNPCN-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.42 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |