C12H15FN2O2S — CID 105382516
3-fluoro-2-[(2-methylthiolan-2-yl)methylamino]pyridine-4-carboxylic acid (PubChem CID 105382516) has the molecular formula C12H15FN2O2S and a molecular weight of 270.33 g/mol. Its IUPAC name is 3-fluoro-2-[(2-methylthiolan-2-yl)methylamino]pyridine-4-carboxylic acid.
| Compound Name | 3-fluoro-2-[(2-methylthiolan-2-yl)methylamino]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 105382516 |
| Molecular Formula | C12H15FN2O2S |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 3-fluoro-2-[(2-methylthiolan-2-yl)methylamino]pyridine-4-carboxylic acid |
| SMILES | CC1(CNc2nccc(C(=O)O)c2F)CCCS1 |
| InChI | InChI=1S/C12H15FN2O2S/c1-12(4-2-6-18-12)7-15-10-9(13)8(11(16)17)3-5-14-10/h3,5H,2,4,6-7H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | NARCFUDMBWGIJO-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |