About [1-(thieno[3,2-c]pyridin-4-ylamino)cyclopentyl]methanol
[1-(thieno[3,2-c]pyridin-4-ylamino)cyclopentyl]methanol (PubChem CID 62519052) has the molecular formula C13H16N2OS
and a molecular weight of 248.35 g/mol. Its IUPAC name is [1-(thieno[3,2-c]pyridin-4-ylamino)cyclopentyl]methanol.
Molecular Properties
| Compound Name | [1-(thieno[3,2-c]pyridin-4-ylamino)cyclopentyl]methanol |
| PubChem CID | 62519052 |
| Molecular Formula | C13H16N2OS |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | [1-(thieno[3,2-c]pyridin-4-ylamino)cyclopentyl]methanol |
| SMILES | OCC1(Nc2nccc3sccc23)CCCC1 |
| InChI | InChI=1S/C13H16N2OS/c16-9-13(5-1-2-6-13)15-12-10-4-8-17-11(10)3-7-14-12/h3-4,7-8,16H,1-2,5-6,9H2,(H,14,15) |
| InChIKey | XYAFAPBLUJULBN-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-(thieno[3,2-c]pyridin-4-ylamino)cyclopentyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(thieno[3,2-c]pyridin-4-ylamino)cyclopentyl]methanol?
The IUPAC name of [1-(thieno[3,2-c]pyridin-4-ylamino)cyclopentyl]methanol (CID 62519052) is [1-(thieno[3,2-c]pyridin-4-ylamino)cyclopentyl]methanol.
What is the SMILES notation for [1-(thieno[3,2-c]pyridin-4-ylamino)cyclopentyl]methanol?
The canonical SMILES for [1-(thieno[3,2-c]pyridin-4-ylamino)cyclopentyl]methanol is OCC1(Nc2nccc3sccc23)CCCC1.
What is the InChIKey of [1-(thieno[3,2-c]pyridin-4-ylamino)cyclopentyl]methanol?
The InChIKey is XYAFAPBLUJULBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2OS/c16-9-13(5-1-2-6-13)15-12-10-4-8-17-11(10)3-7-14-12/h3-4,7-8,16H,1-2,5-6,9H2,(H,14,15).
What are the key properties of [1-(thieno[3,2-c]pyridin-4-ylamino)cyclopentyl]methanol?
[1-(thieno[3,2-c]pyridin-4-ylamino)cyclopentyl]methanol has a molecular weight of 248.35 g/mol, XLogP of 3.01, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(thieno[3,2-c]pyridin-4-ylamino)cyclopentyl]methanol is sourced from PubChem (CID 62519052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).