C14H20N2OS — CID 103844406
2-ethyl-2-[(thieno[3,2-c]pyridin-4-ylamino)methyl]butan-1-ol (PubChem CID 103844406) has the molecular formula C14H20N2OS and a molecular weight of 264.39 g/mol. Its IUPAC name is 2-ethyl-2-[(thieno[3,2-c]pyridin-4-ylamino)methyl]butan-1-ol.
| Compound Name | 2-ethyl-2-[(thieno[3,2-c]pyridin-4-ylamino)methyl]butan-1-ol |
|---|---|
| PubChem CID | 103844406 |
| Molecular Formula | C14H20N2OS |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 2-ethyl-2-[(thieno[3,2-c]pyridin-4-ylamino)methyl]butan-1-ol |
| SMILES | CCC(CC)(CO)CNc1nccc2sccc12 |
| InChI | InChI=1S/C14H20N2OS/c1-3-14(4-2,10-17)9-16-13-11-6-8-18-12(11)5-7-15-13/h5-8,17H,3-4,9-10H2,1-2H3,(H,15,16) |
| InChIKey | WXABCUXBYZJGNX-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |