C13H18N2OS — CID 106171144
3-methyl-3-(thieno[3,2-c]pyridin-4-ylamino)pentan-1-ol (PubChem CID 106171144) has the molecular formula C13H18N2OS and a molecular weight of 250.37 g/mol. Its IUPAC name is 3-methyl-3-(thieno[3,2-c]pyridin-4-ylamino)pentan-1-ol.
| Compound Name | 3-methyl-3-(thieno[3,2-c]pyridin-4-ylamino)pentan-1-ol |
|---|---|
| PubChem CID | 106171144 |
| Molecular Formula | C13H18N2OS |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 3-methyl-3-(thieno[3,2-c]pyridin-4-ylamino)pentan-1-ol |
| SMILES | CCC(C)(CCO)Nc1nccc2sccc12 |
| InChI | InChI=1S/C13H18N2OS/c1-3-13(2,6-8-16)15-12-10-5-9-17-11(10)4-7-14-12/h4-5,7,9,16H,3,6,8H2,1-2H3,(H,14,15) |
| InChIKey | GXHLLTPQPSIZCU-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |