C16H20N2O3 — CID 106171503
3-([1,3]dioxolo[4,5-g]isoquinolin-5-ylamino)-3-methylpentan-1-ol (PubChem CID 106171503) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 3-([1,3]dioxolo[4,5-g]isoquinolin-5-ylamino)-3-methylpentan-1-ol.
| Compound Name | 3-([1,3]dioxolo[4,5-g]isoquinolin-5-ylamino)-3-methylpentan-1-ol |
|---|---|
| PubChem CID | 106171503 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 3-([1,3]dioxolo[4,5-g]isoquinolin-5-ylamino)-3-methylpentan-1-ol |
| SMILES | CCC(C)(CCO)Nc1nccc2cc3c(cc12)OCO3 |
| InChI | InChI=1S/C16H20N2O3/c1-3-16(2,5-7-19)18-15-12-9-14-13(20-10-21-14)8-11(12)4-6-17-15/h4,6,8-9,19H,3,5,7,10H2,1-2H3,(H,17,18) |
| InChIKey | QVPAVKHCCAISGA-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 63.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |