C13H15ClN2S — CID 106124235
N-[(3-chlorocyclopentyl)methyl]thieno[3,2-c]pyridin-4-amine (PubChem CID 106124235) has the molecular formula C13H15ClN2S and a molecular weight of 266.80 g/mol. Its IUPAC name is N-[(3-chlorocyclopentyl)methyl]thieno[3,2-c]pyridin-4-amine.
| Compound Name | N-[(3-chlorocyclopentyl)methyl]thieno[3,2-c]pyridin-4-amine |
|---|---|
| PubChem CID | 106124235 |
| Molecular Formula | C13H15ClN2S |
| Molecular Weight | 266.80 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | N-[(3-chlorocyclopentyl)methyl]thieno[3,2-c]pyridin-4-amine |
| SMILES | ClC1CCC(CNc2nccc3sccc23)C1 |
| InChI | InChI=1S/C13H15ClN2S/c14-10-2-1-9(7-10)8-16-13-11-4-6-17-12(11)3-5-15-13/h3-6,9-10H,1-2,7-8H2,(H,15,16) |
| InChIKey | JUKHSVZOUGCUMT-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.80 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|