C13H14N2O2S — CID 66031975
3-(thieno[3,2-c]pyridin-4-ylamino)cyclopentane-1-carboxylic acid (PubChem CID 66031975) has the molecular formula C13H14N2O2S and a molecular weight of 262.33 g/mol. Its IUPAC name is 3-(thieno[3,2-c]pyridin-4-ylamino)cyclopentane-1-carboxylic acid.
| Compound Name | 3-(thieno[3,2-c]pyridin-4-ylamino)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 66031975 |
| Molecular Formula | C13H14N2O2S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 3-(thieno[3,2-c]pyridin-4-ylamino)cyclopentane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(Nc2nccc3sccc23)C1 |
| InChI | InChI=1S/C13H14N2O2S/c16-13(17)8-1-2-9(7-8)15-12-10-4-6-18-11(10)3-5-14-12/h3-6,8-9H,1-2,7H2,(H,14,15)(H,16,17) |
| InChIKey | CLNHTIRTQQSIOI-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |