C11H12N2O3S — CID 106108525
2-methoxy-3-(thieno[3,2-c]pyridin-4-ylamino)propanoic acid (PubChem CID 106108525) has the molecular formula C11H12N2O3S and a molecular weight of 252.30 g/mol. Its IUPAC name is 2-methoxy-3-(thieno[3,2-c]pyridin-4-ylamino)propanoic acid.
| Compound Name | 2-methoxy-3-(thieno[3,2-c]pyridin-4-ylamino)propanoic acid |
|---|---|
| PubChem CID | 106108525 |
| Molecular Formula | C11H12N2O3S |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 2-methoxy-3-(thieno[3,2-c]pyridin-4-ylamino)propanoic acid |
| SMILES | COC(CNc1nccc2sccc12)C(=O)O |
| InChI | InChI=1S/C11H12N2O3S/c1-16-8(11(14)15)6-13-10-7-3-5-17-9(7)2-4-12-10/h2-5,8H,6H2,1H3,(H,12,13)(H,14,15) |
| InChIKey | LZZSFODGAKNPAW-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |