C16H16N2S — CID 54931071
N-(3-phenylpropyl)thieno[3,2-c]pyridin-4-amine (PubChem CID 54931071) has the molecular formula C16H16N2S and a molecular weight of 268.39 g/mol. Its IUPAC name is N-(3-phenylpropyl)thieno[3,2-c]pyridin-4-amine.
| Compound Name | N-(3-phenylpropyl)thieno[3,2-c]pyridin-4-amine |
|---|---|
| PubChem CID | 54931071 |
| Molecular Formula | C16H16N2S |
| Molecular Weight | 268.39 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | N-(3-phenylpropyl)thieno[3,2-c]pyridin-4-amine |
| SMILES | c1ccc(CCCNc2nccc3sccc23)cc1 |
| InChI | InChI=1S/C16H16N2S/c1-2-5-13(6-3-1)7-4-10-17-16-14-9-12-19-15(14)8-11-18-16/h1-3,5-6,8-9,11-12H,4,7,10H2,(H,17,18) |
| InChIKey | XNHXWVWJKPXVIZ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.39 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|