C16H15ClN2S — CID 65029018
N-(1-chloro-3-phenylpropan-2-yl)thieno[3,2-c]pyridin-4-amine (PubChem CID 65029018) has the molecular formula C16H15ClN2S and a molecular weight of 302.83 g/mol. Its IUPAC name is N-(1-chloro-3-phenylpropan-2-yl)thieno[3,2-c]pyridin-4-amine.
| Compound Name | N-(1-chloro-3-phenylpropan-2-yl)thieno[3,2-c]pyridin-4-amine |
|---|---|
| PubChem CID | 65029018 |
| Molecular Formula | C16H15ClN2S |
| Molecular Weight | 302.83 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | N-(1-chloro-3-phenylpropan-2-yl)thieno[3,2-c]pyridin-4-amine |
| SMILES | ClCC(Cc1ccccc1)Nc1nccc2sccc12 |
| InChI | InChI=1S/C16H15ClN2S/c17-11-13(10-12-4-2-1-3-5-12)19-16-14-7-9-20-15(14)6-8-18-16/h1-9,13H,10-11H2,(H,18,19) |
| InChIKey | XISFQZWIAMVJEF-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.83 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|