C13H14N2S — CID 106231740
N-hex-1-yn-3-ylthieno[3,2-c]pyridin-4-amine (PubChem CID 106231740) has the molecular formula C13H14N2S and a molecular weight of 230.34 g/mol. Its IUPAC name is N-hex-1-yn-3-ylthieno[3,2-c]pyridin-4-amine.
| Compound Name | N-hex-1-yn-3-ylthieno[3,2-c]pyridin-4-amine |
|---|---|
| PubChem CID | 106231740 |
| Molecular Formula | C13H14N2S |
| Molecular Weight | 230.34 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | N-hex-1-yn-3-ylthieno[3,2-c]pyridin-4-amine |
| SMILES | C#CC(CCC)Nc1nccc2sccc12 |
| InChI | InChI=1S/C13H14N2S/c1-3-5-10(4-2)15-13-11-7-9-16-12(11)6-8-14-13/h2,6-10H,3,5H2,1H3,(H,14,15) |
| InChIKey | SYQQPMAINOWAEC-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.34 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|