C12H16N2OS2 — CID 113260876
N-(4-methylsulfinylbutan-2-yl)thieno[3,2-c]pyridin-4-amine (PubChem CID 113260876) has the molecular formula C12H16N2OS2 and a molecular weight of 268.41 g/mol. Its IUPAC name is N-(4-methylsulfinylbutan-2-yl)thieno[3,2-c]pyridin-4-amine.
| Compound Name | N-(4-methylsulfinylbutan-2-yl)thieno[3,2-c]pyridin-4-amine |
|---|---|
| PubChem CID | 113260876 |
| Molecular Formula | C12H16N2OS2 |
| Molecular Weight | 268.41 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | N-(4-methylsulfinylbutan-2-yl)thieno[3,2-c]pyridin-4-amine |
| SMILES | CC(CCS(C)=O)Nc1nccc2sccc12 |
| InChI | InChI=1S/C12H16N2OS2/c1-9(5-8-17(2)15)14-12-10-4-7-16-11(10)3-6-13-12/h3-4,6-7,9H,5,8H2,1-2H3,(H,13,14) |
| InChIKey | INOACYLPYAFJIA-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |