C16H17ClN4 — CID 103386410
N-(1-chloro-3-phenylpropan-2-yl)-1-methylimidazo[4,5-c]pyridin-4-amine (PubChem CID 103386410) has the molecular formula C16H17ClN4 and a molecular weight of 300.79 g/mol. Its IUPAC name is N-(1-chloro-3-phenylpropan-2-yl)-1-methylimidazo[4,5-c]pyridin-4-amine.
| Compound Name | N-(1-chloro-3-phenylpropan-2-yl)-1-methylimidazo[4,5-c]pyridin-4-amine |
|---|---|
| PubChem CID | 103386410 |
| Molecular Formula | C16H17ClN4 |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | N-(1-chloro-3-phenylpropan-2-yl)-1-methylimidazo[4,5-c]pyridin-4-amine |
| SMILES | Cn1cnc2c(NC(CCl)Cc3ccccc3)nccc21 |
| InChI | InChI=1S/C16H17ClN4/c1-21-11-19-15-14(21)7-8-18-16(15)20-13(10-17)9-12-5-3-2-4-6-12/h2-8,11,13H,9-10H2,1H3,(H,18,20) |
| InChIKey | OOIMURUSDDVYOE-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|