C12H17ClN4 — CID 103386457
N-(3-chloro-2,2-dimethylpropyl)-1-methylimidazo[4,5-c]pyridin-4-amine (PubChem CID 103386457) has the molecular formula C12H17ClN4 and a molecular weight of 252.75 g/mol. Its IUPAC name is N-(3-chloro-2,2-dimethylpropyl)-1-methylimidazo[4,5-c]pyridin-4-amine.
| Compound Name | N-(3-chloro-2,2-dimethylpropyl)-1-methylimidazo[4,5-c]pyridin-4-amine |
|---|---|
| PubChem CID | 103386457 |
| Molecular Formula | C12H17ClN4 |
| Molecular Weight | 252.75 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | N-(3-chloro-2,2-dimethylpropyl)-1-methylimidazo[4,5-c]pyridin-4-amine |
| SMILES | Cn1cnc2c(NCC(C)(C)CCl)nccc21 |
| InChI | InChI=1S/C12H17ClN4/c1-12(2,6-13)7-15-11-10-9(4-5-14-11)17(3)8-16-10/h4-5,8H,6-7H2,1-3H3,(H,14,15) |
| InChIKey | XFNRAHPURPTOQI-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.75 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|