C16H18N4 — CID 103385789
1-methyl-N-(2-phenylpropyl)imidazo[4,5-c]pyridin-4-amine (PubChem CID 103385789) has the molecular formula C16H18N4 and a molecular weight of 266.35 g/mol. Its IUPAC name is 1-methyl-N-(2-phenylpropyl)imidazo[4,5-c]pyridin-4-amine.
| Compound Name | 1-methyl-N-(2-phenylpropyl)imidazo[4,5-c]pyridin-4-amine |
|---|---|
| PubChem CID | 103385789 |
| Molecular Formula | C16H18N4 |
| Molecular Weight | 266.35 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 1-methyl-N-(2-phenylpropyl)imidazo[4,5-c]pyridin-4-amine |
| SMILES | CC(CNc1nccc2c1ncn2C)c1ccccc1 |
| InChI | InChI=1S/C16H18N4/c1-12(13-6-4-3-5-7-13)10-18-16-15-14(8-9-17-16)20(2)11-19-15/h3-9,11-12H,10H2,1-2H3,(H,17,18) |
| InChIKey | ALDRKLNJIIEMQC-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.35 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |