C9H10N4O2S — CID 83204037
2-(thieno[2,3-d]pyrimidin-4-ylamino)ethyl carbamate (PubChem CID 83204037) has the molecular formula C9H10N4O2S and a molecular weight of 238.27 g/mol. Its IUPAC name is 2-(thieno[2,3-d]pyrimidin-4-ylamino)ethyl carbamate.
| Compound Name | 2-(thieno[2,3-d]pyrimidin-4-ylamino)ethyl carbamate |
|---|---|
| PubChem CID | 83204037 |
| Molecular Formula | C9H10N4O2S |
| Molecular Weight | 238.27 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 2-(thieno[2,3-d]pyrimidin-4-ylamino)ethyl carbamate |
| SMILES | NC(=O)OCCNc1ncnc2sccc12 |
| InChI | InChI=1S/C9H10N4O2S/c10-9(14)15-3-2-11-7-6-1-4-16-8(6)13-5-12-7/h1,4-5H,2-3H2,(H2,10,14)(H,11,12,13) |
| InChIKey | KXPJGUUWTKANGT-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.27 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|