C9H8N4S — CID 9107580
3-(thieno[2,3-d]pyrimidin-4-ylamino)propanenitrile (PubChem CID 9107580) has the molecular formula C9H8N4S and a molecular weight of 204.26 g/mol. Its IUPAC name is 3-(thieno[2,3-d]pyrimidin-4-ylamino)propanenitrile.
| Compound Name | 3-(thieno[2,3-d]pyrimidin-4-ylamino)propanenitrile |
|---|---|
| PubChem CID | 9107580 |
| Molecular Formula | C9H8N4S |
| Molecular Weight | 204.26 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | 3-(thieno[2,3-d]pyrimidin-4-ylamino)propanenitrile |
| SMILES | N#CCCNc1ncnc2sccc12 |
| InChI | InChI=1S/C9H8N4S/c10-3-1-4-11-8-7-2-5-14-9(7)13-6-12-8/h2,5-6H,1,4H2,(H,11,12,13) |
| InChIKey | LGDOWILZXGKDPG-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.26 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|