C11H17N5S2 — CID 103335722
2-hydrazinyl-N-(4-methylsulfanylbutyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 103335722) has the molecular formula C11H17N5S2 and a molecular weight of 283.43 g/mol. Its IUPAC name is 2-hydrazinyl-N-(4-methylsulfanylbutyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-hydrazinyl-N-(4-methylsulfanylbutyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 103335722 |
| Molecular Formula | C11H17N5S2 |
| Molecular Weight | 283.43 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 2-hydrazinyl-N-(4-methylsulfanylbutyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | CSCCCCNc1nc(NN)nc2sccc12 |
| InChI | InChI=1S/C11H17N5S2/c1-17-6-3-2-5-13-9-8-4-7-18-10(8)15-11(14-9)16-12/h4,7H,2-3,5-6,12H2,1H3,(H2,13,14,15,16) |
| InChIKey | JFTADTFZRYVDRM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.43 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|