C9H13N5OS — CID 103335379
3-[(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)amino]propan-1-ol (PubChem CID 103335379) has the molecular formula C9H13N5OS and a molecular weight of 239.30 g/mol. Its IUPAC name is 3-[(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)amino]propan-1-ol.
| Compound Name | 3-[(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)amino]propan-1-ol |
|---|---|
| PubChem CID | 103335379 |
| Molecular Formula | C9H13N5OS |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | 3-[(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)amino]propan-1-ol |
| SMILES | NNc1nc(NCCCO)c2ccsc2n1 |
| InChI | InChI=1S/C9H13N5OS/c10-14-9-12-7(11-3-1-4-15)6-2-5-16-8(6)13-9/h2,5,15H,1,3-4,10H2,(H2,11,12,13,14) |
| InChIKey | DXWLIKRKBYCNKU-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|