C10H15N5O2S — CID 103334449
3-[(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)amino]-2-methylpropane-1,2-diol (PubChem CID 103334449) has the molecular formula C10H15N5O2S and a molecular weight of 269.33 g/mol. Its IUPAC name is 3-[(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)amino]-2-methylpropane-1,2-diol.
| Compound Name | 3-[(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)amino]-2-methylpropane-1,2-diol |
|---|---|
| PubChem CID | 103334449 |
| Molecular Formula | C10H15N5O2S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 3-[(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)amino]-2-methylpropane-1,2-diol |
| SMILES | CC(O)(CO)CNc1nc(NN)nc2sccc12 |
| InChI | InChI=1S/C10H15N5O2S/c1-10(17,5-16)4-12-7-6-2-3-18-8(6)14-9(13-7)15-11/h2-3,16-17H,4-5,11H2,1H3,(H2,12,13,14,15) |
| InChIKey | YICLRLMSFOCWSR-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 116.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|