C9H12N6OS — CID 103332330
3-[(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)amino]propanamide (PubChem CID 103332330) has the molecular formula C9H12N6OS and a molecular weight of 252.30 g/mol. Its IUPAC name is 3-[(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)amino]propanamide.
| Compound Name | 3-[(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)amino]propanamide |
|---|---|
| PubChem CID | 103332330 |
| Molecular Formula | C9H12N6OS |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 3-[(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)amino]propanamide |
| SMILES | NNc1nc(NCCC(N)=O)c2ccsc2n1 |
| InChI | InChI=1S/C9H12N6OS/c10-6(16)1-3-12-7-5-2-4-17-8(5)14-9(13-7)15-11/h2,4H,1,3,11H2,(H2,10,16)(H2,12,13,14,15) |
| InChIKey | IUNLAAAEPXUIQX-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 118.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|