C12H16N6OS — CID 103335700
N-[2-[(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]cyclopropanecarboxamide (PubChem CID 103335700) has the molecular formula C12H16N6OS and a molecular weight of 292.37 g/mol. Its IUPAC name is N-[2-[(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]cyclopropanecarboxamide.
| Compound Name | N-[2-[(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 103335700 |
| Molecular Formula | C12H16N6OS |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | N-[2-[(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]cyclopropanecarboxamide |
| SMILES | NNc1nc(NCCNC(=O)C2CC2)c2ccsc2n1 |
| InChI | InChI=1S/C12H16N6OS/c13-18-12-16-9(8-3-6-20-11(8)17-12)14-4-5-15-10(19)7-1-2-7/h3,6-7H,1-2,4-5,13H2,(H,15,19)(H2,14,16,17,18) |
| InChIKey | JPEVFKDSINFBDI-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|