C10H13N5OS — CID 103334408
3-[(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)amino]cyclobutan-1-ol (PubChem CID 103334408) has the molecular formula C10H13N5OS and a molecular weight of 251.31 g/mol. Its IUPAC name is 3-[(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)amino]cyclobutan-1-ol.
| Compound Name | 3-[(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)amino]cyclobutan-1-ol |
|---|---|
| PubChem CID | 103334408 |
| Molecular Formula | C10H13N5OS |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 3-[(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)amino]cyclobutan-1-ol |
| SMILES | NNc1nc(NC2CC(O)C2)c2ccsc2n1 |
| InChI | InChI=1S/C10H13N5OS/c11-15-10-13-8(12-5-3-6(16)4-5)7-1-2-17-9(7)14-10/h1-2,5-6,16H,3-4,11H2,(H2,12,13,14,15) |
| InChIKey | DORXBLCPHYZMLH-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|