C10H9N5S2 — CID 103334460
2-hydrazinyl-N-thiophen-3-ylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 103334460) has the molecular formula C10H9N5S2 and a molecular weight of 263.35 g/mol. Its IUPAC name is 2-hydrazinyl-N-thiophen-3-ylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-hydrazinyl-N-thiophen-3-ylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 103334460 |
| Molecular Formula | C10H9N5S2 |
| Molecular Weight | 263.35 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | 2-hydrazinyl-N-thiophen-3-ylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | NNc1nc(Nc2ccsc2)c2ccsc2n1 |
| InChI | InChI=1S/C10H9N5S2/c11-15-10-13-8(12-6-1-3-16-5-6)7-2-4-17-9(7)14-10/h1-5H,11H2,(H2,12,13,14,15) |
| InChIKey | GBXWJJQOYMAOIS-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.35 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|