C13H9FN6S — CID 103335500
5-fluoro-2-[(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)amino]benzonitrile (PubChem CID 103335500) has the molecular formula C13H9FN6S and a molecular weight of 300.32 g/mol. Its IUPAC name is 5-fluoro-2-[(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)amino]benzonitrile.
| Compound Name | 5-fluoro-2-[(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)amino]benzonitrile |
|---|---|
| PubChem CID | 103335500 |
| Molecular Formula | C13H9FN6S |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 5-fluoro-2-[(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)amino]benzonitrile |
| SMILES | N#Cc1cc(F)ccc1Nc1nc(NN)nc2sccc12 |
| InChI | InChI=1S/C13H9FN6S/c14-8-1-2-10(7(5-8)6-15)17-11-9-3-4-21-12(9)19-13(18-11)20-16/h1-5H,16H2,(H2,17,18,19,20) |
| InChIKey | WGIDPEJXWQCFRT-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 99.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|