C12H10IN5S — CID 103334778
2-hydrazinyl-N-(2-iodophenyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 103334778) has the molecular formula C12H10IN5S and a molecular weight of 383.22 g/mol. Its IUPAC name is 2-hydrazinyl-N-(2-iodophenyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-hydrazinyl-N-(2-iodophenyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 103334778 |
| Molecular Formula | C12H10IN5S |
| Molecular Weight | 383.22 g/mol |
| Exact Mass | 382.97 |
| IUPAC Name | 2-hydrazinyl-N-(2-iodophenyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | NNc1nc(Nc2ccccc2I)c2ccsc2n1 |
| InChI | InChI=1S/C12H10IN5S/c13-8-3-1-2-4-9(8)15-10-7-5-6-19-11(7)17-12(16-10)18-14/h1-6H,14H2,(H2,15,16,17,18) |
| InChIKey | OUKQKXWLWFANEZ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.22 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|