C15H17N5S — CID 103335640
2-hydrazinyl-N-(2-phenylpropyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 103335640) has the molecular formula C15H17N5S and a molecular weight of 299.40 g/mol. Its IUPAC name is 2-hydrazinyl-N-(2-phenylpropyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-hydrazinyl-N-(2-phenylpropyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 103335640 |
| Molecular Formula | C15H17N5S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 2-hydrazinyl-N-(2-phenylpropyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | CC(CNc1nc(NN)nc2sccc12)c1ccccc1 |
| InChI | InChI=1S/C15H17N5S/c1-10(11-5-3-2-4-6-11)9-17-13-12-7-8-21-14(12)19-15(18-13)20-16/h2-8,10H,9,16H2,1H3,(H2,17,18,19,20) |
| InChIKey | QIEBTZCPNXSWNM-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|