C13H21N5S — CID 103333804
2-hydrazinyl-N-(5-methylhexan-2-yl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 103333804) has the molecular formula C13H21N5S and a molecular weight of 279.41 g/mol. Its IUPAC name is 2-hydrazinyl-N-(5-methylhexan-2-yl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-hydrazinyl-N-(5-methylhexan-2-yl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 103333804 |
| Molecular Formula | C13H21N5S |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 2-hydrazinyl-N-(5-methylhexan-2-yl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | CC(C)CCC(C)Nc1nc(NN)nc2sccc12 |
| InChI | InChI=1S/C13H21N5S/c1-8(2)4-5-9(3)15-11-10-6-7-19-12(10)17-13(16-11)18-14/h6-9H,4-5,14H2,1-3H3,(H2,15,16,17,18) |
| InChIKey | SNHKOIVUDILEIG-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|