C11H16N4S2 — CID 107766413
[4-(3-methylbutylsulfanyl)thieno[2,3-d]pyrimidin-2-yl]hydrazine (PubChem CID 107766413) has the molecular formula C11H16N4S2 and a molecular weight of 268.41 g/mol. Its IUPAC name is [4-(3-methylbutylsulfanyl)thieno[2,3-d]pyrimidin-2-yl]hydrazine.
| Compound Name | [4-(3-methylbutylsulfanyl)thieno[2,3-d]pyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 107766413 |
| Molecular Formula | C11H16N4S2 |
| Molecular Weight | 268.41 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | [4-(3-methylbutylsulfanyl)thieno[2,3-d]pyrimidin-2-yl]hydrazine |
| SMILES | CC(C)CCSc1nc(NN)nc2sccc12 |
| InChI | InChI=1S/C11H16N4S2/c1-7(2)3-5-16-9-8-4-6-17-10(8)14-11(13-9)15-12/h4,6-7H,3,5,12H2,1-2H3,(H,13,14,15) |
| InChIKey | OAXAOCQINYIEBH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.41 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|