C10H10N6S2 — CID 103336586
[4-(1-methylpyrazol-4-yl)sulfanylthieno[2,3-d]pyrimidin-2-yl]hydrazine (PubChem CID 103336586) has the molecular formula C10H10N6S2 and a molecular weight of 278.37 g/mol. Its IUPAC name is [4-(1-methylpyrazol-4-yl)sulfanylthieno[2,3-d]pyrimidin-2-yl]hydrazine.
| Compound Name | [4-(1-methylpyrazol-4-yl)sulfanylthieno[2,3-d]pyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 103336586 |
| Molecular Formula | C10H10N6S2 |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | [4-(1-methylpyrazol-4-yl)sulfanylthieno[2,3-d]pyrimidin-2-yl]hydrazine |
| SMILES | Cn1cc(Sc2nc(NN)nc3sccc23)cn1 |
| InChI | InChI=1S/C10H10N6S2/c1-16-5-6(4-12-16)18-9-7-2-3-17-8(7)13-10(14-9)15-11/h2-5H,11H2,1H3,(H,13,14,15) |
| InChIKey | UAZPBWZMJOVSBC-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|