C9H14N8S — CID 80923499
4-hydrazinyl-N,N-dimethyl-6-(1-methylpyrazol-4-yl)sulfanyl-1,3,5-triazin-2-amine (PubChem CID 80923499) has the molecular formula C9H14N8S and a molecular weight of 266.33 g/mol. Its IUPAC name is 4-hydrazinyl-N,N-dimethyl-6-(1-methylpyrazol-4-yl)sulfanyl-1,3,5-triazin-2-amine.
| Compound Name | 4-hydrazinyl-N,N-dimethyl-6-(1-methylpyrazol-4-yl)sulfanyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80923499 |
| Molecular Formula | C9H14N8S |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 4-hydrazinyl-N,N-dimethyl-6-(1-methylpyrazol-4-yl)sulfanyl-1,3,5-triazin-2-amine |
| SMILES | CN(C)c1nc(NN)nc(Sc2cnn(C)c2)n1 |
| InChI | InChI=1S/C9H14N8S/c1-16(2)8-12-7(15-10)13-9(14-8)18-6-4-11-17(3)5-6/h4-5H,10H2,1-3H3,(H,12,13,14,15) |
| InChIKey | UQJXRNIJDFFJTD-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 97.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|