C11H13FN6S — CID 80921868
4-(2-fluorophenyl)sulfanyl-6-hydrazinyl-N,N-dimethyl-1,3,5-triazin-2-amine (PubChem CID 80921868) has the molecular formula C11H13FN6S and a molecular weight of 280.33 g/mol. Its IUPAC name is 4-(2-fluorophenyl)sulfanyl-6-hydrazinyl-N,N-dimethyl-1,3,5-triazin-2-amine.
| Compound Name | 4-(2-fluorophenyl)sulfanyl-6-hydrazinyl-N,N-dimethyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80921868 |
| Molecular Formula | C11H13FN6S |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 4-(2-fluorophenyl)sulfanyl-6-hydrazinyl-N,N-dimethyl-1,3,5-triazin-2-amine |
| SMILES | CN(C)c1nc(NN)nc(Sc2ccccc2F)n1 |
| InChI | InChI=1S/C11H13FN6S/c1-18(2)10-14-9(17-13)15-11(16-10)19-8-6-4-3-5-7(8)12/h3-6H,13H2,1-2H3,(H,14,15,16,17) |
| InChIKey | KNYXIEFECBGHFY-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|