C12H16N6OS — CID 80931212
4-hydrazinyl-6-(4-methoxyphenyl)sulfanyl-N,N-dimethyl-1,3,5-triazin-2-amine (PubChem CID 80931212) has the molecular formula C12H16N6OS and a molecular weight of 292.37 g/mol. Its IUPAC name is 4-hydrazinyl-6-(4-methoxyphenyl)sulfanyl-N,N-dimethyl-1,3,5-triazin-2-amine.
| Compound Name | 4-hydrazinyl-6-(4-methoxyphenyl)sulfanyl-N,N-dimethyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80931212 |
| Molecular Formula | C12H16N6OS |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 4-hydrazinyl-6-(4-methoxyphenyl)sulfanyl-N,N-dimethyl-1,3,5-triazin-2-amine |
| SMILES | COc1ccc(Sc2nc(NN)nc(N(C)C)n2)cc1 |
| InChI | InChI=1S/C12H16N6OS/c1-18(2)11-14-10(17-13)15-12(16-11)20-9-6-4-8(19-3)5-7-9/h4-7H,13H2,1-3H3,(H,14,15,16,17) |
| InChIKey | UEKJDHQGCMDSRE-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|