C11H13N7OS2 — CID 103336601
3-(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)sulfanyl-4-propyl-1H-1,2,4-triazol-5-one (PubChem CID 103336601) has the molecular formula C11H13N7OS2 and a molecular weight of 323.41 g/mol. Its IUPAC name is 3-(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)sulfanyl-4-propyl-1H-1,2,4-triazol-5-one.
| Compound Name | 3-(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)sulfanyl-4-propyl-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 103336601 |
| Molecular Formula | C11H13N7OS2 |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 3-(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)sulfanyl-4-propyl-1H-1,2,4-triazol-5-one |
| SMILES | CCCn1c(Sc2nc(NN)nc3sccc23)n[nH]c1=O |
| InChI | InChI=1S/C11H13N7OS2/c1-2-4-18-10(19)16-17-11(18)21-8-6-3-5-20-7(6)13-9(14-8)15-12/h3,5H,2,4,12H2,1H3,(H,16,19)(H,13,14,15) |
| InChIKey | IUVXAXNASQQQJY-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 114.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|