C10H9Cl3N4OS — CID 102752352
4-propyl-3-[(3,5,6-trichloro-2-pyridinyl)sulfanyl]-1H-1,2,4-triazol-5-one (PubChem CID 102752352) has the molecular formula C10H9Cl3N4OS and a molecular weight of 339.64 g/mol. Its IUPAC name is 4-propyl-3-[(3,5,6-trichloro-2-pyridinyl)sulfanyl]-1H-1,2,4-triazol-5-one.
| Compound Name | 4-propyl-3-[(3,5,6-trichloro-2-pyridinyl)sulfanyl]-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 102752352 |
| Molecular Formula | C10H9Cl3N4OS |
| Molecular Weight | 339.64 g/mol |
| Exact Mass | 337.96 |
| IUPAC Name | 4-propyl-3-[(3,5,6-trichloro-2-pyridinyl)sulfanyl]-1H-1,2,4-triazol-5-one |
| SMILES | CCCn1c(Sc2nc(Cl)c(Cl)cc2Cl)n[nH]c1=O |
| InChI | InChI=1S/C10H9Cl3N4OS/c1-2-3-17-9(18)15-16-10(17)19-8-6(12)4-5(11)7(13)14-8/h4H,2-3H2,1H3,(H,15,18) |
| InChIKey | JOPWTELCRWVCRC-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.64 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|