C10H12ClN5OS — CID 113317092
3-[(3-amino-6-chloro-2-pyridinyl)sulfanyl]-4-propyl-1H-1,2,4-triazol-5-one (PubChem CID 113317092) has the molecular formula C10H12ClN5OS and a molecular weight of 285.76 g/mol. Its IUPAC name is 3-[(3-amino-6-chloro-2-pyridinyl)sulfanyl]-4-propyl-1H-1,2,4-triazol-5-one.
| Compound Name | 3-[(3-amino-6-chloro-2-pyridinyl)sulfanyl]-4-propyl-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 113317092 |
| Molecular Formula | C10H12ClN5OS |
| Molecular Weight | 285.76 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | 3-[(3-amino-6-chloro-2-pyridinyl)sulfanyl]-4-propyl-1H-1,2,4-triazol-5-one |
| SMILES | CCCn1c(Sc2nc(Cl)ccc2N)n[nH]c1=O |
| InChI | InChI=1S/C10H12ClN5OS/c1-2-5-16-9(17)14-15-10(16)18-8-6(12)3-4-7(11)13-8/h3-4H,2,5,12H2,1H3,(H,14,17) |
| InChIKey | VGSNCZVGVXVIKT-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.76 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|