C9H8ClN5O3S — CID 62883600
3-[(6-chloro-3-nitro-2-pyridinyl)sulfanyl]-4-ethyl-1H-1,2,4-triazol-5-one (PubChem CID 62883600) has the molecular formula C9H8ClN5O3S and a molecular weight of 301.72 g/mol. Its IUPAC name is 3-[(6-chloro-3-nitro-2-pyridinyl)sulfanyl]-4-ethyl-1H-1,2,4-triazol-5-one.
| Compound Name | 3-[(6-chloro-3-nitro-2-pyridinyl)sulfanyl]-4-ethyl-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 62883600 |
| Molecular Formula | C9H8ClN5O3S |
| Molecular Weight | 301.72 g/mol |
| Exact Mass | 301.00 |
| IUPAC Name | 3-[(6-chloro-3-nitro-2-pyridinyl)sulfanyl]-4-ethyl-1H-1,2,4-triazol-5-one |
| SMILES | CCn1c(Sc2nc(Cl)ccc2[N+](=O)[O-])n[nH]c1=O |
| InChI | InChI=1S/C9H8ClN5O3S/c1-2-14-8(16)12-13-9(14)19-7-5(15(17)18)3-4-6(10)11-7/h3-4H,2H2,1H3,(H,12,16) |
| InChIKey | QNCBYOANPWPHQI-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 106.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.72 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|