C8H9N7O3S — CID 80929026
3-[(6-hydrazinyl-3-nitro-2-pyridinyl)sulfanyl]-4-methyl-1H-1,2,4-triazol-5-one (PubChem CID 80929026) has the molecular formula C8H9N7O3S and a molecular weight of 283.27 g/mol. Its IUPAC name is 3-[(6-hydrazinyl-3-nitro-2-pyridinyl)sulfanyl]-4-methyl-1H-1,2,4-triazol-5-one.
| Compound Name | 3-[(6-hydrazinyl-3-nitro-2-pyridinyl)sulfanyl]-4-methyl-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 80929026 |
| Molecular Formula | C8H9N7O3S |
| Molecular Weight | 283.27 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 3-[(6-hydrazinyl-3-nitro-2-pyridinyl)sulfanyl]-4-methyl-1H-1,2,4-triazol-5-one |
| SMILES | Cn1c(Sc2nc(NN)ccc2[N+](=O)[O-])n[nH]c1=O |
| InChI | InChI=1S/C8H9N7O3S/c1-14-7(16)12-13-8(14)19-6-4(15(17)18)2-3-5(10-6)11-9/h2-3H,9H2,1H3,(H,10,11)(H,12,16) |
| InChIKey | HYJBCXLMALQPLT-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 144.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.27 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|