C8H12N4O2S — CID 80924423
(5-nitro-6-propylsulfanyl-2-pyridinyl)hydrazine (PubChem CID 80924423) has the molecular formula C8H12N4O2S and a molecular weight of 228.28 g/mol. Its IUPAC name is (5-nitro-6-propylsulfanyl-2-pyridinyl)hydrazine.
| Compound Name | (5-nitro-6-propylsulfanyl-2-pyridinyl)hydrazine |
|---|---|
| PubChem CID | 80924423 |
| Molecular Formula | C8H12N4O2S |
| Molecular Weight | 228.28 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | (5-nitro-6-propylsulfanyl-2-pyridinyl)hydrazine |
| SMILES | CCCSc1nc(NN)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H12N4O2S/c1-2-5-15-8-6(12(13)14)3-4-7(10-8)11-9/h3-4H,2,5,9H2,1H3,(H,10,11) |
| InChIKey | SJRUCEPUZPDVIC-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 94.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.28 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|