C8H12N4O4S — CID 80926673
3-[(6-hydrazinyl-3-nitro-2-pyridinyl)sulfanyl]propane-1,2-diol (PubChem CID 80926673) has the molecular formula C8H12N4O4S and a molecular weight of 260.27 g/mol. Its IUPAC name is 3-[(6-hydrazinyl-3-nitro-2-pyridinyl)sulfanyl]propane-1,2-diol.
| Compound Name | 3-[(6-hydrazinyl-3-nitro-2-pyridinyl)sulfanyl]propane-1,2-diol |
|---|---|
| PubChem CID | 80926673 |
| Molecular Formula | C8H12N4O4S |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 3-[(6-hydrazinyl-3-nitro-2-pyridinyl)sulfanyl]propane-1,2-diol |
| SMILES | NNc1ccc([N+](=O)[O-])c(SCC(O)CO)n1 |
| InChI | InChI=1S/C8H12N4O4S/c9-11-7-2-1-6(12(15)16)8(10-7)17-4-5(14)3-13/h1-2,5,13-14H,3-4,9H2,(H,10,11) |
| InChIKey | XBNPPNIJQAXIPB-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 134.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|