C12H12N2O4S — CID 79683275
3-(5-nitroquinolin-8-yl)sulfanylpropane-1,2-diol (PubChem CID 79683275) has the molecular formula C12H12N2O4S and a molecular weight of 280.31 g/mol. Its IUPAC name is 3-(5-nitroquinolin-8-yl)sulfanylpropane-1,2-diol.
| Compound Name | 3-(5-nitroquinolin-8-yl)sulfanylpropane-1,2-diol |
|---|---|
| PubChem CID | 79683275 |
| Molecular Formula | C12H12N2O4S |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 3-(5-nitroquinolin-8-yl)sulfanylpropane-1,2-diol |
| SMILES | O=[N+]([O-])c1ccc(SCC(O)CO)c2ncccc12 |
| InChI | InChI=1S/C12H12N2O4S/c15-6-8(16)7-19-11-4-3-10(14(17)18)9-2-1-5-13-12(9)11/h1-5,8,15-16H,6-7H2 |
| InChIKey | DVQVCVXQLZZOOP-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|