C16H23N3O8 — CID 86268277
(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol;5-nitroquinolin-8-ol (PubChem CID 86268277) has the molecular formula C16H23N3O8 and a molecular weight of 385.37 g/mol. Its IUPAC name is (2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol;5-nitroquinolin-8-ol.
| Compound Name | (2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol;5-nitroquinolin-8-ol |
|---|---|
| PubChem CID | 86268277 |
| Molecular Formula | C16H23N3O8 |
| Molecular Weight | 385.37 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | (2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol;5-nitroquinolin-8-ol |
| SMILES | CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.O=[N+]([O-])c1ccc(O)c2ncccc12 |
| InChI | InChI=1S/C9H6N2O3.C7H17NO5/c12-8-4-3-7(11(13)14)6-2-1-5-10-9(6)8;1-8-2-4(10)6(12)7(13)5(11)3-9/h1-5,12H;4-13H,2-3H2,1H3/t;4-,5+,6+,7+/m.0/s1 |
| InChIKey | VCOYFBQMGLMLOV-WZTVWXICSA-N |
| XLogP | -1.51 |
| TPSA | 189.44 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.37 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|