About aniline;5-nitroquinolin-8-ol
aniline;5-nitroquinolin-8-ol (PubChem CID 90427564) has the molecular formula C15H13N3O3
and a molecular weight of 283.29 g/mol. Its IUPAC name is aniline;5-nitroquinolin-8-ol.
Molecular Properties
| Compound Name | aniline;5-nitroquinolin-8-ol |
| PubChem CID | 90427564 |
| Molecular Formula | C15H13N3O3 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | aniline;5-nitroquinolin-8-ol |
| SMILES | Nc1ccccc1.O=[N+]([O-])c1ccc(O)c2ncccc12 |
| InChI | InChI=1S/C9H6N2O3.C6H7N/c12-8-4-3-7(11(13)14)6-2-1-5-10-9(6)8;7-6-4-2-1-3-5-6/h1-5,12H;1-5H,7H2 |
| InChIKey | SEKQXQNGQYALCD-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 102.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze aniline;5-nitroquinolin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aniline;5-nitroquinolin-8-ol?
The IUPAC name of aniline;5-nitroquinolin-8-ol (CID 90427564) is aniline;5-nitroquinolin-8-ol.
What is the SMILES notation for aniline;5-nitroquinolin-8-ol?
The canonical SMILES for aniline;5-nitroquinolin-8-ol is Nc1ccccc1.O=[N+]([O-])c1ccc(O)c2ncccc12.
What is the InChIKey of aniline;5-nitroquinolin-8-ol?
The InChIKey is SEKQXQNGQYALCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2O3.C6H7N/c12-8-4-3-7(11(13)14)6-2-1-5-10-9(6)8;7-6-4-2-1-3-5-6/h1-5,12H;1-5H,7H2.
What are the key properties of aniline;5-nitroquinolin-8-ol?
aniline;5-nitroquinolin-8-ol has a molecular weight of 283.29 g/mol, XLogP of 3.12, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for aniline;5-nitroquinolin-8-ol is sourced from PubChem (CID 90427564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).