C8H11N3O4S — CID 79815553
3-[(6-amino-5-nitro-2-pyridinyl)sulfanyl]propane-1,2-diol (PubChem CID 79815553) has the molecular formula C8H11N3O4S and a molecular weight of 245.26 g/mol. Its IUPAC name is 3-[(6-amino-5-nitro-2-pyridinyl)sulfanyl]propane-1,2-diol.
| Compound Name | 3-[(6-amino-5-nitro-2-pyridinyl)sulfanyl]propane-1,2-diol |
|---|---|
| PubChem CID | 79815553 |
| Molecular Formula | C8H11N3O4S |
| Molecular Weight | 245.26 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 3-[(6-amino-5-nitro-2-pyridinyl)sulfanyl]propane-1,2-diol |
| SMILES | Nc1nc(SCC(O)CO)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H11N3O4S/c9-8-6(11(14)15)1-2-7(10-8)16-4-5(13)3-12/h1-2,5,12-13H,3-4H2,(H2,9,10) |
| InChIKey | OYBHPLXTUGENGB-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 122.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.26 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|