C13H19N3O4S — CID 148695842
tert-butyl 4-[(6-amino-5-nitro-2-pyridinyl)sulfanyl]butanoate (PubChem CID 148695842) has the molecular formula C13H19N3O4S and a molecular weight of 313.38 g/mol. Its IUPAC name is tert-butyl 4-[(6-amino-5-nitro-2-pyridinyl)sulfanyl]butanoate.
| Compound Name | tert-butyl 4-[(6-amino-5-nitro-2-pyridinyl)sulfanyl]butanoate |
|---|---|
| PubChem CID | 148695842 |
| Molecular Formula | C13H19N3O4S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | tert-butyl 4-[(6-amino-5-nitro-2-pyridinyl)sulfanyl]butanoate |
| SMILES | CC(C)(C)OC(=O)CCCSc1ccc([N+](=O)[O-])c(N)n1 |
| InChI | InChI=1S/C13H19N3O4S/c1-13(2,3)20-11(17)5-4-8-21-10-7-6-9(16(18)19)12(14)15-10/h6-7H,4-5,8H2,1-3H3,(H2,14,15) |
| InChIKey | NUJVIAUJXHGBKD-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 108.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|