C10H16N4O3 — CID 113450416
6-N-(2-methoxy-2-methylpropyl)-3-nitropyridine-2,6-diamine (PubChem CID 113450416) has the molecular formula C10H16N4O3 and a molecular weight of 240.26 g/mol. Its IUPAC name is 6-N-(2-methoxy-2-methylpropyl)-3-nitropyridine-2,6-diamine.
| Compound Name | 6-N-(2-methoxy-2-methylpropyl)-3-nitropyridine-2,6-diamine |
|---|---|
| PubChem CID | 113450416 |
| Molecular Formula | C10H16N4O3 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 6-N-(2-methoxy-2-methylpropyl)-3-nitropyridine-2,6-diamine |
| SMILES | COC(C)(C)CNc1ccc([N+](=O)[O-])c(N)n1 |
| InChI | InChI=1S/C10H16N4O3/c1-10(2,17-3)6-12-8-5-4-7(14(15)16)9(11)13-8/h4-5H,6H2,1-3H3,(H3,11,12,13) |
| InChIKey | QDQVAUWBHVMQMX-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 103.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|