C11H18N4O2 — CID 106329524
6-N-(3-methylpentan-3-yl)-3-nitropyridine-2,6-diamine (PubChem CID 106329524) has the molecular formula C11H18N4O2 and a molecular weight of 238.29 g/mol. Its IUPAC name is 6-N-(3-methylpentan-3-yl)-3-nitropyridine-2,6-diamine.
| Compound Name | 6-N-(3-methylpentan-3-yl)-3-nitropyridine-2,6-diamine |
|---|---|
| PubChem CID | 106329524 |
| Molecular Formula | C11H18N4O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 6-N-(3-methylpentan-3-yl)-3-nitropyridine-2,6-diamine |
| SMILES | CCC(C)(CC)Nc1ccc([N+](=O)[O-])c(N)n1 |
| InChI | InChI=1S/C11H18N4O2/c1-4-11(3,5-2)14-9-7-6-8(15(16)17)10(12)13-9/h6-7H,4-5H2,1-3H3,(H3,12,13,14) |
| InChIKey | LMNJMJZWDWPQCV-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 94.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|