C10H17N5O2 — CID 79825900
6-N-[2-(dimethylamino)propyl]-3-nitropyridine-2,6-diamine (PubChem CID 79825900) has the molecular formula C10H17N5O2 and a molecular weight of 239.28 g/mol. Its IUPAC name is 6-N-[2-(dimethylamino)propyl]-3-nitropyridine-2,6-diamine.
| Compound Name | 6-N-[2-(dimethylamino)propyl]-3-nitropyridine-2,6-diamine |
|---|---|
| PubChem CID | 79825900 |
| Molecular Formula | C10H17N5O2 |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 6-N-[2-(dimethylamino)propyl]-3-nitropyridine-2,6-diamine |
| SMILES | CC(CNc1ccc([N+](=O)[O-])c(N)n1)N(C)C |
| InChI | InChI=1S/C10H17N5O2/c1-7(14(2)3)6-12-9-5-4-8(15(16)17)10(11)13-9/h4-5,7H,6H2,1-3H3,(H3,11,12,13) |
| InChIKey | VZHOIFBPKHNHNK-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 97.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|