C10H12N6O3S — CID 62884570
3-[(4-hydrazinyl-3-nitrophenyl)methylsulfanyl]-4-methyl-1H-1,2,4-triazol-5-one (PubChem CID 62884570) has the molecular formula C10H12N6O3S and a molecular weight of 296.31 g/mol. Its IUPAC name is 3-[(4-hydrazinyl-3-nitrophenyl)methylsulfanyl]-4-methyl-1H-1,2,4-triazol-5-one.
| Compound Name | 3-[(4-hydrazinyl-3-nitrophenyl)methylsulfanyl]-4-methyl-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 62884570 |
| Molecular Formula | C10H12N6O3S |
| Molecular Weight | 296.31 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 3-[(4-hydrazinyl-3-nitrophenyl)methylsulfanyl]-4-methyl-1H-1,2,4-triazol-5-one |
| SMILES | Cn1c(SCc2ccc(NN)c([N+](=O)[O-])c2)n[nH]c1=O |
| InChI | InChI=1S/C10H12N6O3S/c1-15-9(17)13-14-10(15)20-5-6-2-3-7(12-11)8(4-6)16(18)19/h2-4,12H,5,11H2,1H3,(H,13,17) |
| InChIKey | QRBUHPIYVJLZNU-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 131.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.31 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|